C10H7BrCl2N2OS — CID 168581614
2-bromo-4-chloro-6-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenol (PubChem CID 168581614) has the molecular formula C10H7BrCl2N2OS and a molecular weight of 354.06 g/mol. Its IUPAC name is 2-bromo-4-chloro-6-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenol.
| Compound Name | 2-bromo-4-chloro-6-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenol |
|---|---|
| PubChem CID | 168581614 |
| Molecular Formula | C10H7BrCl2N2OS |
| Molecular Weight | 354.06 g/mol |
| Exact Mass | 351.88 |
| IUPAC Name | 2-bromo-4-chloro-6-[(2-chloro-1,3-thiazol-5-yl)methylamino]phenol |
| SMILES | Oc1c(Br)cc(Cl)cc1NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C10H7BrCl2N2OS/c11-7-1-5(12)2-8(9(7)16)14-3-6-4-15-10(13)17-6/h1-2,4,14,16H,3H2 |
| InChIKey | NPIHAQQFRMRKNF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.06 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|