C10H8ClFN2OS — CID 168580346
2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-5-fluorophenol (PubChem CID 168580346) has the molecular formula C10H8ClFN2OS and a molecular weight of 258.70 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-5-fluorophenol.
| Compound Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-5-fluorophenol |
|---|---|
| PubChem CID | 168580346 |
| Molecular Formula | C10H8ClFN2OS |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylamino]-5-fluorophenol |
| SMILES | Oc1cc(F)ccc1NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C10H8ClFN2OS/c11-10-14-5-7(16-10)4-13-8-2-1-6(12)3-9(8)15/h1-3,5,13,15H,4H2 |
| InChIKey | OSEOGPXPYLXRPK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|