C14H17ClFN3OS — CID 168581737
2-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-fluoro-1-N-(3-methoxypropyl)benzene-1,2-diamine (PubChem CID 168581737) has the molecular formula C14H17ClFN3OS and a molecular weight of 329.83 g/mol. Its IUPAC name is 2-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-fluoro-1-N-(3-methoxypropyl)benzene-1,2-diamine.
| Compound Name | 2-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-fluoro-1-N-(3-methoxypropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 168581737 |
| Molecular Formula | C14H17ClFN3OS |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-N-[(2-chloro-1,3-thiazol-5-yl)methyl]-4-fluoro-1-N-(3-methoxypropyl)benzene-1,2-diamine |
| SMILES | COCCCNc1ccc(F)cc1NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C14H17ClFN3OS/c1-20-6-2-5-17-12-4-3-10(16)7-13(12)18-8-11-9-19-14(15)21-11/h3-4,7,9,17-18H,2,5-6,8H2,1H3 |
| InChIKey | MENDITLXGRULGY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|