C15H18ClN3O2S — CID 168583889
4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-N-(2-methoxyethyl)-3-methylbenzamide (PubChem CID 168583889) has the molecular formula C15H18ClN3O2S and a molecular weight of 339.85 g/mol. Its IUPAC name is 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-N-(2-methoxyethyl)-3-methylbenzamide.
| Compound Name | 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-N-(2-methoxyethyl)-3-methylbenzamide |
|---|---|
| PubChem CID | 168583889 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-[(2-chloro-1,3-thiazol-5-yl)methylamino]-N-(2-methoxyethyl)-3-methylbenzamide |
| SMILES | COCCNC(=O)c1ccc(NCc2cnc(Cl)s2)c(C)c1 |
| InChI | InChI=1S/C15H18ClN3O2S/c1-10-7-11(14(20)17-5-6-21-2)3-4-13(10)18-8-12-9-19-15(16)22-12/h3-4,7,9,18H,5-6,8H2,1-2H3,(H,17,20) |
| InChIKey | YOWYWKSQDRNZOU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|