C23H26ClN3O2S — CID 168583738
N-[2-(4-tert-butylphenoxy)ethyl]-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzamide (PubChem CID 168583738) has the molecular formula C23H26ClN3O2S and a molecular weight of 444.00 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 168583738 |
| Molecular Formula | C23H26ClN3O2S |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzamide |
| SMILES | CC(C)(C)c1ccc(OCCNC(=O)c2ccccc2NCc2cnc(Cl)s2)cc1 |
| InChI | InChI=1S/C23H26ClN3O2S/c1-23(2,3)16-8-10-17(11-9-16)29-13-12-25-21(28)19-6-4-5-7-20(19)26-14-18-15-27-22(24)30-18/h4-11,15,26H,12-14H2,1-3H3,(H,25,28) |
| InChIKey | QJNHYBMBQXNMTL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|