C17H21ClN4O3S — CID 168581999
3-methylbutyl N-[[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoyl]amino]carbamate (PubChem CID 168581999) has the molecular formula C17H21ClN4O3S and a molecular weight of 396.90 g/mol. Its IUPAC name is 3-methylbutyl N-[[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoyl]amino]carbamate.
| Compound Name | 3-methylbutyl N-[[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoyl]amino]carbamate |
|---|---|
| PubChem CID | 168581999 |
| Molecular Formula | C17H21ClN4O3S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 3-methylbutyl N-[[2-[(2-chloro-1,3-thiazol-5-yl)methylamino]benzoyl]amino]carbamate |
| SMILES | CC(C)CCOC(=O)NNC(=O)c1ccccc1NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C17H21ClN4O3S/c1-11(2)7-8-25-17(24)22-21-15(23)13-5-3-4-6-14(13)19-9-12-10-20-16(18)26-12/h3-6,10-11,19H,7-9H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | MXOSYQGGEHTURE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|