C14H20ClN3O5 — CID 168639683
2-methoxyethyl N-[[2-[(3-chloro-2-hydroxypropyl)amino]benzoyl]amino]carbamate (PubChem CID 168639683) has the molecular formula C14H20ClN3O5 and a molecular weight of 345.78 g/mol. Its IUPAC name is 2-methoxyethyl N-[[2-[(3-chloro-2-hydroxypropyl)amino]benzoyl]amino]carbamate.
| Compound Name | 2-methoxyethyl N-[[2-[(3-chloro-2-hydroxypropyl)amino]benzoyl]amino]carbamate |
|---|---|
| PubChem CID | 168639683 |
| Molecular Formula | C14H20ClN3O5 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-methoxyethyl N-[[2-[(3-chloro-2-hydroxypropyl)amino]benzoyl]amino]carbamate |
| SMILES | COCCOC(=O)NNC(=O)c1ccccc1NCC(O)CCl |
| InChI | InChI=1S/C14H20ClN3O5/c1-22-6-7-23-14(21)18-17-13(20)11-4-2-3-5-12(11)16-9-10(19)8-15/h2-5,10,16,19H,6-9H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | KYPFGZZDMBGATH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|