C15H23ClN2O3 — CID 168639161
2-[(3-chloro-2-hydroxypropyl)amino]-N-(3-ethoxypropyl)benzamide (PubChem CID 168639161) has the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. Its IUPAC name is 2-[(3-chloro-2-hydroxypropyl)amino]-N-(3-ethoxypropyl)benzamide.
| Compound Name | 2-[(3-chloro-2-hydroxypropyl)amino]-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 168639161 |
| Molecular Formula | C15H23ClN2O3 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-[(3-chloro-2-hydroxypropyl)amino]-N-(3-ethoxypropyl)benzamide |
| SMILES | CCOCCCNC(=O)c1ccccc1NCC(O)CCl |
| InChI | InChI=1S/C15H23ClN2O3/c1-2-21-9-5-8-17-15(20)13-6-3-4-7-14(13)18-11-12(19)10-16/h3-4,6-7,12,18-19H,2,5,8-11H2,1H3,(H,17,20) |
| InChIKey | XNKNNXJNGOAMHO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|