C16H18ClN3O2 — CID 168638648
2-[(3-chloro-2-hydroxypropyl)amino]-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 168638648) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is 2-[(3-chloro-2-hydroxypropyl)amino]-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 2-[(3-chloro-2-hydroxypropyl)amino]-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 168638648 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-[(3-chloro-2-hydroxypropyl)amino]-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccccn1)c1ccccc1NCC(O)CCl |
| InChI | InChI=1S/C16H18ClN3O2/c17-9-13(21)11-19-15-7-2-1-6-14(15)16(22)20-10-12-5-3-4-8-18-12/h1-8,13,19,21H,9-11H2,(H,20,22) |
| InChIKey | YNNWHBWYJRWBFF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|