C11H15ClN2O2 — CID 168640662
2-[(3-chloro-2-hydroxypropyl)amino]-N-methylbenzamide (PubChem CID 168640662) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 2-[(3-chloro-2-hydroxypropyl)amino]-N-methylbenzamide.
| Compound Name | 2-[(3-chloro-2-hydroxypropyl)amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 168640662 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-[(3-chloro-2-hydroxypropyl)amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1NCC(O)CCl |
| InChI | InChI=1S/C11H15ClN2O2/c1-13-11(16)9-4-2-3-5-10(9)14-7-8(15)6-12/h2-5,8,14-15H,6-7H2,1H3,(H,13,16) |
| InChIKey | GRDKGMFYEOGRJH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|