C20H17F2N3OS — CID 25469086
2-[4-(difluoromethylsulfanyl)anilino]-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 25469086) has the molecular formula C20H17F2N3OS and a molecular weight of 385.44 g/mol. Its IUPAC name is 2-[4-(difluoromethylsulfanyl)anilino]-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 2-[4-(difluoromethylsulfanyl)anilino]-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 25469086 |
| Molecular Formula | C20H17F2N3OS |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-[4-(difluoromethylsulfanyl)anilino]-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccccn1)c1ccccc1Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C20H17F2N3OS/c21-20(22)27-16-10-8-14(9-11-16)25-18-7-2-1-6-17(18)19(26)24-13-15-5-3-4-12-23-15/h1-12,20,25H,13H2,(H,24,26) |
| InChIKey | QGNCVWPKQCOYAV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |