C18H19F2N3OS — CID 1182724
[2-[4-(difluoromethylsulfanyl)anilino]phenyl]-piperazin-1-ylmethanone (PubChem CID 1182724) has the molecular formula C18H19F2N3OS and a molecular weight of 363.43 g/mol. Its IUPAC name is [2-[4-(difluoromethylsulfanyl)anilino]phenyl]-piperazin-1-ylmethanone.
| Compound Name | [2-[4-(difluoromethylsulfanyl)anilino]phenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 1182724 |
| Molecular Formula | C18H19F2N3OS |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | [2-[4-(difluoromethylsulfanyl)anilino]phenyl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1ccccc1Nc1ccc(SC(F)F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C18H19F2N3OS/c19-18(20)25-14-7-5-13(6-8-14)22-16-4-2-1-3-15(16)17(24)23-11-9-21-10-12-23/h1-8,18,21-22H,9-12H2 |
| InChIKey | GVGMTNTXHPNULH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |