C20H21F2N3O2S — CID 112767631
N-[2-(cyclopropanecarbonylamino)ethyl]-2-[4-(difluoromethylsulfanyl)anilino]benzamide (PubChem CID 112767631) has the molecular formula C20H21F2N3O2S and a molecular weight of 405.47 g/mol. Its IUPAC name is N-[2-(cyclopropanecarbonylamino)ethyl]-2-[4-(difluoromethylsulfanyl)anilino]benzamide.
| Compound Name | N-[2-(cyclopropanecarbonylamino)ethyl]-2-[4-(difluoromethylsulfanyl)anilino]benzamide |
|---|---|
| PubChem CID | 112767631 |
| Molecular Formula | C20H21F2N3O2S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[2-(cyclopropanecarbonylamino)ethyl]-2-[4-(difluoromethylsulfanyl)anilino]benzamide |
| SMILES | O=C(NCCNC(=O)C1CC1)c1ccccc1Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C20H21F2N3O2S/c21-20(22)28-15-9-7-14(8-10-15)25-17-4-2-1-3-16(17)19(27)24-12-11-23-18(26)13-5-6-13/h1-4,7-10,13,20,25H,5-6,11-12H2,(H,23,26)(H,24,27) |
| InChIKey | FSQFHAYCHFFCLZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|