C25H23F2N3O2S — CID 112792151
[4-[2-[4-(difluoromethylsulfanyl)anilino]benzoyl]piperazin-1-yl]-phenylmethanone (PubChem CID 112792151) has the molecular formula C25H23F2N3O2S and a molecular weight of 467.54 g/mol. Its IUPAC name is [4-[2-[4-(difluoromethylsulfanyl)anilino]benzoyl]piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-[2-[4-(difluoromethylsulfanyl)anilino]benzoyl]piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 112792151 |
| Molecular Formula | C25H23F2N3O2S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | [4-[2-[4-(difluoromethylsulfanyl)anilino]benzoyl]piperazin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCN(C(=O)c2ccccc2Nc2ccc(SC(F)F)cc2)CC1 |
| InChI | InChI=1S/C25H23F2N3O2S/c26-25(27)33-20-12-10-19(11-13-20)28-22-9-5-4-8-21(22)24(32)30-16-14-29(15-17-30)23(31)18-6-2-1-3-7-18/h1-13,25,28H,14-17H2 |
| InChIKey | PMNBKZUUXIDAOM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |