C21H16F4N2OS2 — CID 21179535
2-[4-(difluoromethylsulfanyl)anilino]-N-[2-(difluoromethylsulfanyl)phenyl]benzamide (PubChem CID 21179535) has the molecular formula C21H16F4N2OS2 and a molecular weight of 452.50 g/mol. Its IUPAC name is 2-[4-(difluoromethylsulfanyl)anilino]-N-[2-(difluoromethylsulfanyl)phenyl]benzamide.
| Compound Name | 2-[4-(difluoromethylsulfanyl)anilino]-N-[2-(difluoromethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 21179535 |
| Molecular Formula | C21H16F4N2OS2 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 2-[4-(difluoromethylsulfanyl)anilino]-N-[2-(difluoromethylsulfanyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1SC(F)F)c1ccccc1Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C21H16F4N2OS2/c22-20(23)29-14-11-9-13(10-12-14)26-16-6-2-1-5-15(16)19(28)27-17-7-3-4-8-18(17)30-21(24)25/h1-12,20-21,26H,(H,27,28) |
| InChIKey | MCYWSSCJYQEPRU-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |