C15H13F2NO2S — CID 26181019
N-[2-(difluoromethylsulfanyl)phenyl]-2-methoxybenzamide (PubChem CID 26181019) has the molecular formula C15H13F2NO2S and a molecular weight of 309.34 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-2-methoxybenzamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 26181019 |
| Molecular Formula | C15H13F2NO2S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C15H13F2NO2S/c1-20-12-8-4-2-6-10(12)14(19)18-11-7-3-5-9-13(11)21-15(16)17/h2-9,15H,1H3,(H,18,19) |
| InChIKey | GIVWUQJOHAPUSI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |