C20H22F2N2OS — CID 2313407
azepan-1-yl-[2-[4-(difluoromethylsulfanyl)anilino]phenyl]methanone (PubChem CID 2313407) has the molecular formula C20H22F2N2OS and a molecular weight of 376.47 g/mol. Its IUPAC name is azepan-1-yl-[2-[4-(difluoromethylsulfanyl)anilino]phenyl]methanone.
| Compound Name | azepan-1-yl-[2-[4-(difluoromethylsulfanyl)anilino]phenyl]methanone |
|---|---|
| PubChem CID | 2313407 |
| Molecular Formula | C20H22F2N2OS |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | azepan-1-yl-[2-[4-(difluoromethylsulfanyl)anilino]phenyl]methanone |
| SMILES | O=C(c1ccccc1Nc1ccc(SC(F)F)cc1)N1CCCCCC1 |
| InChI | InChI=1S/C20H22F2N2OS/c21-20(22)26-16-11-9-15(10-12-16)23-18-8-4-3-7-17(18)19(25)24-13-5-1-2-6-14-24/h3-4,7-12,20,23H,1-2,5-6,13-14H2 |
| InChIKey | IBDAZHHSRBJXSW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |