C20H20F2N2O4S — CID 16540557
(2-morpholin-4-yl-2-oxoethyl) 2-[4-(difluoromethylsulfanyl)anilino]benzoate (PubChem CID 16540557) has the molecular formula C20H20F2N2O4S and a molecular weight of 422.45 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 2-[4-(difluoromethylsulfanyl)anilino]benzoate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 2-[4-(difluoromethylsulfanyl)anilino]benzoate |
|---|---|
| PubChem CID | 16540557 |
| Molecular Formula | C20H20F2N2O4S |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 2-[4-(difluoromethylsulfanyl)anilino]benzoate |
| SMILES | O=C(OCC(=O)N1CCOCC1)c1ccccc1Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C20H20F2N2O4S/c21-20(22)29-15-7-5-14(6-8-15)23-17-4-2-1-3-16(17)19(26)28-13-18(25)24-9-11-27-12-10-24/h1-8,20,23H,9-13H2 |
| InChIKey | TZAYTQMJINFWML-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |