C23H17F2N3O3S — CID 2379257
[2-(2-cyanoanilino)-2-oxoethyl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate (PubChem CID 2379257) has the molecular formula C23H17F2N3O3S and a molecular weight of 453.47 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate |
|---|---|
| PubChem CID | 2379257 |
| Molecular Formula | C23H17F2N3O3S |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate |
| SMILES | N#Cc1ccccc1NC(=O)COC(=O)c1ccccc1Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C23H17F2N3O3S/c24-23(25)32-17-11-9-16(10-12-17)27-20-8-4-2-6-18(20)22(30)31-14-21(29)28-19-7-3-1-5-15(19)13-26/h1-12,23,27H,14H2,(H,28,29) |
| InChIKey | OQZJVRPGJFPZQW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |