C20H22F2N2O4S — CID 55318748
[2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate (PubChem CID 55318748) has the molecular formula C20H22F2N2O4S and a molecular weight of 424.47 g/mol. Its IUPAC name is [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate.
| Compound Name | [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate |
|---|---|
| PubChem CID | 55318748 |
| Molecular Formula | C20H22F2N2O4S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate |
| SMILES | COCC(C)NC(=O)COC(=O)c1ccccc1Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C20H22F2N2O4S/c1-13(11-27-2)23-18(25)12-28-19(26)16-5-3-4-6-17(16)24-14-7-9-15(10-8-14)29-20(21)22/h3-10,13,20,24H,11-12H2,1-2H3,(H,23,25) |
| InChIKey | NZJDCPOBGSOWIS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |