C13H17ClN2O4 — CID 115936108
[2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 3-amino-2-chlorobenzoate (PubChem CID 115936108) has the molecular formula C13H17ClN2O4 and a molecular weight of 300.74 g/mol. Its IUPAC name is [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 3-amino-2-chlorobenzoate.
| Compound Name | [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 3-amino-2-chlorobenzoate |
|---|---|
| PubChem CID | 115936108 |
| Molecular Formula | C13H17ClN2O4 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 3-amino-2-chlorobenzoate |
| SMILES | COCC(C)NC(=O)COC(=O)c1cccc(N)c1Cl |
| InChI | InChI=1S/C13H17ClN2O4/c1-8(6-19-2)16-11(17)7-20-13(18)9-4-3-5-10(15)12(9)14/h3-5,8H,6-7,15H2,1-2H3,(H,16,17) |
| InChIKey | XLFSGUZJGHWZCU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|