C17H15F2NO4S — CID 42964430
methyl 2-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethoxy]benzoate (PubChem CID 42964430) has the molecular formula C17H15F2NO4S and a molecular weight of 367.37 g/mol. Its IUPAC name is methyl 2-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethoxy]benzoate.
| Compound Name | methyl 2-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 42964430 |
| Molecular Formula | C17H15F2NO4S |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | methyl 2-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethoxy]benzoate |
| SMILES | COC(=O)c1ccccc1OCC(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C17H15F2NO4S/c1-23-16(22)13-4-2-3-5-14(13)24-10-15(21)20-11-6-8-12(9-7-11)25-17(18)19/h2-9,17H,10H2,1H3,(H,20,21) |
| InChIKey | DBOGPIABVVBUGA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |