C20H17F2N3O2S — CID 24633206
N-[4-(difluoromethylsulfanyl)phenyl]-2-[2-(1-imidazol-1-ylethenyl)phenoxy]acetamide (PubChem CID 24633206) has the molecular formula C20H17F2N3O2S and a molecular weight of 401.44 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-2-[2-(1-imidazol-1-ylethenyl)phenoxy]acetamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-[2-(1-imidazol-1-ylethenyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 24633206 |
| Molecular Formula | C20H17F2N3O2S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-[2-(1-imidazol-1-ylethenyl)phenoxy]acetamide |
| SMILES | C=C(c1ccccc1OCC(=O)Nc1ccc(SC(F)F)cc1)n1ccnc1 |
| InChI | InChI=1S/C20H17F2N3O2S/c1-14(25-11-10-23-13-25)17-4-2-3-5-18(17)27-12-19(26)24-15-6-8-16(9-7-15)28-20(21)22/h2-11,13,20H,1,12H2,(H,24,26) |
| InChIKey | JYRBQBQTPTWXHF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |