C22H20F2N2O3S2 — CID 26795665
2-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethoxy]-N-(2-thiophen-2-ylethyl)benzamide (PubChem CID 26795665) has the molecular formula C22H20F2N2O3S2 and a molecular weight of 462.54 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethoxy]-N-(2-thiophen-2-ylethyl)benzamide.
| Compound Name | 2-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethoxy]-N-(2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 26795665 |
| Molecular Formula | C22H20F2N2O3S2 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 2-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethoxy]-N-(2-thiophen-2-ylethyl)benzamide |
| SMILES | O=C(COc1ccccc1C(=O)NCCc1cccs1)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C22H20F2N2O3S2/c23-22(24)31-17-9-7-15(8-10-17)26-20(27)14-29-19-6-2-1-5-18(19)21(28)25-12-11-16-4-3-13-30-16/h1-10,13,22H,11-12,14H2,(H,25,28)(H,26,27) |
| InChIKey | SEXIZBUWFXBTTC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |