C13H12F2N2OS2 — CID 78806718
2-(difluoromethylsulfanyl)-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide (PubChem CID 78806718) has the molecular formula C13H12F2N2OS2 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 78806718 |
| Molecular Formula | C13H12F2N2OS2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCc1cccs1)c1cccnc1SC(F)F |
| InChI | InChI=1S/C13H12F2N2OS2/c14-13(15)20-12-10(4-1-6-17-12)11(18)16-7-5-9-3-2-8-19-9/h1-4,6,8,13H,5,7H2,(H,16,18) |
| InChIKey | XZLZDTBREZEPPX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |