C15H13BrF2N2O2S — CID 55976011
N-[2-(3-bromophenoxy)ethyl]-2-(difluoromethylsulfanyl)pyridine-3-carboxamide (PubChem CID 55976011) has the molecular formula C15H13BrF2N2O2S and a molecular weight of 403.25 g/mol. Its IUPAC name is N-[2-(3-bromophenoxy)ethyl]-2-(difluoromethylsulfanyl)pyridine-3-carboxamide.
| Compound Name | N-[2-(3-bromophenoxy)ethyl]-2-(difluoromethylsulfanyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55976011 |
| Molecular Formula | C15H13BrF2N2O2S |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | N-[2-(3-bromophenoxy)ethyl]-2-(difluoromethylsulfanyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCOc1cccc(Br)c1)c1cccnc1SC(F)F |
| InChI | InChI=1S/C15H13BrF2N2O2S/c16-10-3-1-4-11(9-10)22-8-7-19-13(21)12-5-2-6-20-14(12)23-15(17)18/h1-6,9,15H,7-8H2,(H,19,21) |
| InChIKey | YCSPWWPYZRZLEO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|