C14H14F2N2O2S2 — CID 18113801
2-(difluoromethylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]pyridine-3-carboxamide (PubChem CID 18113801) has the molecular formula C14H14F2N2O2S2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 18113801 |
| Molecular Formula | C14H14F2N2O2S2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCSCc1ccco1)c1cccnc1SC(F)F |
| InChI | InChI=1S/C14H14F2N2O2S2/c15-14(16)22-13-11(4-1-5-18-13)12(19)17-6-8-21-9-10-3-2-7-20-10/h1-5,7,14H,6,8-9H2,(H,17,19) |
| InChIKey | QRESZJAZGUHTIH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|