C15H16F2N2O2S — CID 24641935
2-(difluoromethylsulfanyl)-N-[4-(furan-2-yl)butan-2-yl]pyridine-3-carboxamide (PubChem CID 24641935) has the molecular formula C15H16F2N2O2S and a molecular weight of 326.37 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[4-(furan-2-yl)butan-2-yl]pyridine-3-carboxamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[4-(furan-2-yl)butan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24641935 |
| Molecular Formula | C15H16F2N2O2S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[4-(furan-2-yl)butan-2-yl]pyridine-3-carboxamide |
| SMILES | CC(CCc1ccco1)NC(=O)c1cccnc1SC(F)F |
| InChI | InChI=1S/C15H16F2N2O2S/c1-10(6-7-11-4-3-9-21-11)19-13(20)12-5-2-8-18-14(12)22-15(16)17/h2-5,8-10,15H,6-7H2,1H3,(H,19,20) |
| InChIKey | IKGRIJUYAKCGBN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |