C15H15F2NO2 — CID 62661107
2,3-difluoro-N-[4-(furan-2-yl)butan-2-yl]benzamide (PubChem CID 62661107) has the molecular formula C15H15F2NO2 and a molecular weight of 279.29 g/mol. Its IUPAC name is 2,3-difluoro-N-[4-(furan-2-yl)butan-2-yl]benzamide.
| Compound Name | 2,3-difluoro-N-[4-(furan-2-yl)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 62661107 |
| Molecular Formula | C15H15F2NO2 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2,3-difluoro-N-[4-(furan-2-yl)butan-2-yl]benzamide |
| SMILES | CC(CCc1ccco1)NC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C15H15F2NO2/c1-10(7-8-11-4-3-9-20-11)18-15(19)12-5-2-6-13(16)14(12)17/h2-6,9-10H,7-8H2,1H3,(H,18,19) |
| InChIKey | BKIBCFPPGOCZMJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |