C16H18FNO2 — CID 79769993
2-fluoro-N-[4-(furan-2-yl)butan-2-yl]-4-methylbenzamide (PubChem CID 79769993) has the molecular formula C16H18FNO2 and a molecular weight of 275.32 g/mol. Its IUPAC name is 2-fluoro-N-[4-(furan-2-yl)butan-2-yl]-4-methylbenzamide.
| Compound Name | 2-fluoro-N-[4-(furan-2-yl)butan-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 79769993 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-fluoro-N-[4-(furan-2-yl)butan-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(C)CCc2ccco2)c(F)c1 |
| InChI | InChI=1S/C16H18FNO2/c1-11-5-8-14(15(17)10-11)16(19)18-12(2)6-7-13-4-3-9-20-13/h3-5,8-10,12H,6-7H2,1-2H3,(H,18,19) |
| InChIKey | FKOWOQMAQUHMPT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |