C17H20Cl2N2O4S — CID 7354302
2,4-dichloro-5-(dimethylsulfamoyl)-N-[(2S)-4-(furan-2-yl)butan-2-yl]benzamide (PubChem CID 7354302) has the molecular formula C17H20Cl2N2O4S and a molecular weight of 419.33 g/mol. Its IUPAC name is 2,4-dichloro-5-(dimethylsulfamoyl)-N-[(2S)-4-(furan-2-yl)butan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-5-(dimethylsulfamoyl)-N-[(2S)-4-(furan-2-yl)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 7354302 |
| Molecular Formula | C17H20Cl2N2O4S |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 2,4-dichloro-5-(dimethylsulfamoyl)-N-[(2S)-4-(furan-2-yl)butan-2-yl]benzamide |
| SMILES | C[C@@H](CCc1ccco1)NC(=O)c1cc(S(=O)(=O)N(C)C)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H20Cl2N2O4S/c1-11(6-7-12-5-4-8-25-12)20-17(22)13-9-16(15(19)10-14(13)18)26(23,24)21(2)3/h4-5,8-11H,6-7H2,1-3H3,(H,20,22)/t11-/m0/s1 |
| InChIKey | DKOZMEZXLFVQIM-NSHDSACASA-N |
| XLogP | 3.59 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |