C19H25ClN2O4S — CID 55364133
2-chloro-5-(diethylsulfamoyl)-N-[4-(furan-2-yl)butan-2-yl]benzamide (PubChem CID 55364133) has the molecular formula C19H25ClN2O4S and a molecular weight of 412.94 g/mol. Its IUPAC name is 2-chloro-5-(diethylsulfamoyl)-N-[4-(furan-2-yl)butan-2-yl]benzamide.
| Compound Name | 2-chloro-5-(diethylsulfamoyl)-N-[4-(furan-2-yl)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 55364133 |
| Molecular Formula | C19H25ClN2O4S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2-chloro-5-(diethylsulfamoyl)-N-[4-(furan-2-yl)butan-2-yl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)NC(C)CCc2ccco2)c1 |
| InChI | InChI=1S/C19H25ClN2O4S/c1-4-22(5-2)27(24,25)16-10-11-18(20)17(13-16)19(23)21-14(3)8-9-15-7-6-12-26-15/h6-7,10-14H,4-5,8-9H2,1-3H3,(H,21,23) |
| InChIKey | PQOOZRLUOKVKFT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |