C12H13F5N2O2S — CID 86929035
2-(difluoromethylsulfanyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]pyridine-3-carboxamide (PubChem CID 86929035) has the molecular formula C12H13F5N2O2S and a molecular weight of 344.31 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]pyridine-3-carboxamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 86929035 |
| Molecular Formula | C12H13F5N2O2S |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCCOCC(F)(F)F)c1cccnc1SC(F)F |
| InChI | InChI=1S/C12H13F5N2O2S/c13-11(14)22-10-8(3-1-4-19-10)9(20)18-5-2-6-21-7-12(15,16)17/h1,3-4,11H,2,5-7H2,(H,18,20) |
| InChIKey | ULXBKNBYNRNBFV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|