C16H13Cl2F2N3O2S — CID 78868278
N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-2-(difluoromethylsulfanyl)pyridine-3-carboxamide (PubChem CID 78868278) has the molecular formula C16H13Cl2F2N3O2S and a molecular weight of 420.27 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-2-(difluoromethylsulfanyl)pyridine-3-carboxamide.
| Compound Name | N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-2-(difluoromethylsulfanyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 78868278 |
| Molecular Formula | C16H13Cl2F2N3O2S |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | N-[2-[(3,4-dichlorobenzoyl)amino]ethyl]-2-(difluoromethylsulfanyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cccnc1SC(F)F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2F2N3O2S/c17-11-4-3-9(8-12(11)18)13(24)21-6-7-22-14(25)10-2-1-5-23-15(10)26-16(19)20/h1-5,8,16H,6-7H2,(H,21,24)(H,22,25) |
| InChIKey | YTBVURNLLJQFJT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|