C16H13Cl2FN2O2 — CID 34819338
3,4-dichloro-N-[2-[(3-fluorobenzoyl)amino]ethyl]benzamide (PubChem CID 34819338) has the molecular formula C16H13Cl2FN2O2 and a molecular weight of 355.20 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[(3-fluorobenzoyl)amino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[(3-fluorobenzoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 34819338 |
| Molecular Formula | C16H13Cl2FN2O2 |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 3,4-dichloro-N-[2-[(3-fluorobenzoyl)amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccc(Cl)c(Cl)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H13Cl2FN2O2/c17-13-5-4-11(9-14(13)18)16(23)21-7-6-20-15(22)10-2-1-3-12(19)8-10/h1-5,8-9H,6-7H2,(H,20,22)(H,21,23) |
| InChIKey | LVKGQZQCKLFZOX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|