C19H19Cl2FN2O2 — CID 86975289
3,4-dichloro-N-[2-[[2-(3-fluorophenyl)-2-methylpropanoyl]amino]ethyl]benzamide (PubChem CID 86975289) has the molecular formula C19H19Cl2FN2O2 and a molecular weight of 397.28 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[[2-(3-fluorophenyl)-2-methylpropanoyl]amino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[[2-(3-fluorophenyl)-2-methylpropanoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 86975289 |
| Molecular Formula | C19H19Cl2FN2O2 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3,4-dichloro-N-[2-[[2-(3-fluorophenyl)-2-methylpropanoyl]amino]ethyl]benzamide |
| SMILES | CC(C)(C(=O)NCCNC(=O)c1ccc(Cl)c(Cl)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C19H19Cl2FN2O2/c1-19(2,13-4-3-5-14(22)11-13)18(26)24-9-8-23-17(25)12-6-7-15(20)16(21)10-12/h3-7,10-11H,8-9H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | DDRAPCOFXNKLTF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|