C12H16ClNO2 — CID 110437674
2-(3-chlorophenyl)-N-(2-hydroxyethyl)-2-methylpropanamide (PubChem CID 110437674) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-(2-hydroxyethyl)-2-methylpropanamide.
| Compound Name | 2-(3-chlorophenyl)-N-(2-hydroxyethyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 110437674 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-(3-chlorophenyl)-N-(2-hydroxyethyl)-2-methylpropanamide |
| SMILES | CC(C)(C(=O)NCCO)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H16ClNO2/c1-12(2,11(16)14-6-7-15)9-4-3-5-10(13)8-9/h3-5,8,15H,6-7H2,1-2H3,(H,14,16) |
| InChIKey | OVGYPUQAEYKGJZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |