C16H16ClNO4 — CID 119245730
5-[[[2-(3-chlorophenyl)-2-methylpropanoyl]amino]methyl]furan-2-carboxylic acid (PubChem CID 119245730) has the molecular formula C16H16ClNO4 and a molecular weight of 321.76 g/mol. Its IUPAC name is 5-[[[2-(3-chlorophenyl)-2-methylpropanoyl]amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[[2-(3-chlorophenyl)-2-methylpropanoyl]amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 119245730 |
| Molecular Formula | C16H16ClNO4 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-[[[2-(3-chlorophenyl)-2-methylpropanoyl]amino]methyl]furan-2-carboxylic acid |
| SMILES | CC(C)(C(=O)NCc1ccc(C(=O)O)o1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16ClNO4/c1-16(2,10-4-3-5-11(17)8-10)15(21)18-9-12-6-7-13(22-12)14(19)20/h3-8H,9H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | KUJKAHHGMRKQHP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |