C17H18ClNO4 — CID 119226257
5-[[[2-(3-chlorophenyl)-2-methylpropanoyl]amino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 119226257) has the molecular formula C17H18ClNO4 and a molecular weight of 335.79 g/mol. Its IUPAC name is 5-[[[2-(3-chlorophenyl)-2-methylpropanoyl]amino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[[2-(3-chlorophenyl)-2-methylpropanoyl]amino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 119226257 |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 5-[[[2-(3-chlorophenyl)-2-methylpropanoyl]amino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CNC(=O)C(C)(C)c2cccc(Cl)c2)cc1C(=O)O |
| InChI | InChI=1S/C17H18ClNO4/c1-10-14(15(20)21)8-13(23-10)9-19-16(22)17(2,3)11-5-4-6-12(18)7-11/h4-8H,9H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | FJLBWCGLYWLPOH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |