C14H11ClFNO4 — CID 82873027
5-[[(3-chloro-4-fluorobenzoyl)amino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 82873027) has the molecular formula C14H11ClFNO4 and a molecular weight of 311.70 g/mol. Its IUPAC name is 5-[[(3-chloro-4-fluorobenzoyl)amino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[(3-chloro-4-fluorobenzoyl)amino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 82873027 |
| Molecular Formula | C14H11ClFNO4 |
| Molecular Weight | 311.70 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 5-[[(3-chloro-4-fluorobenzoyl)amino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CNC(=O)c2ccc(F)c(Cl)c2)cc1C(=O)O |
| InChI | InChI=1S/C14H11ClFNO4/c1-7-10(14(19)20)5-9(21-7)6-17-13(18)8-2-3-12(16)11(15)4-8/h2-5H,6H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | LIBXFQPLDOJBMH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.70 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |