C14H12FNO4 — CID 61025078
5-[[(2-fluorobenzoyl)amino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 61025078) has the molecular formula C14H12FNO4 and a molecular weight of 277.25 g/mol. Its IUPAC name is 5-[[(2-fluorobenzoyl)amino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[(2-fluorobenzoyl)amino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 61025078 |
| Molecular Formula | C14H12FNO4 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 5-[[(2-fluorobenzoyl)amino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CNC(=O)c2ccccc2F)cc1C(=O)O |
| InChI | InChI=1S/C14H12FNO4/c1-8-11(14(18)19)6-9(20-8)7-16-13(17)10-4-2-3-5-12(10)15/h2-6H,7H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | XNJKHYLXKAMOOR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |