C17H16FNO4 — CID 119226939
5-[[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 119226939) has the molecular formula C17H16FNO4 and a molecular weight of 317.32 g/mol. Its IUPAC name is 5-[[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 119226939 |
| Molecular Formula | C17H16FNO4 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 5-[[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CNC(=O)C2(c3ccccc3F)CC2)cc1C(=O)O |
| InChI | InChI=1S/C17H16FNO4/c1-10-12(15(20)21)8-11(23-10)9-19-16(22)17(6-7-17)13-4-2-3-5-14(13)18/h2-5,8H,6-7,9H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | MEMDKAKCPZBOKG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |