C14H12ClNO5 — CID 61024297
5-[[(4-chloro-2-hydroxybenzoyl)amino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 61024297) has the molecular formula C14H12ClNO5 and a molecular weight of 309.70 g/mol. Its IUPAC name is 5-[[(4-chloro-2-hydroxybenzoyl)amino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[(4-chloro-2-hydroxybenzoyl)amino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 61024297 |
| Molecular Formula | C14H12ClNO5 |
| Molecular Weight | 309.70 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 5-[[(4-chloro-2-hydroxybenzoyl)amino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CNC(=O)c2ccc(Cl)cc2O)cc1C(=O)O |
| InChI | InChI=1S/C14H12ClNO5/c1-7-11(14(19)20)5-9(21-7)6-16-13(18)10-3-2-8(15)4-12(10)17/h2-5,17H,6H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | HOBOJVYKWHFURQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.70 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |