C13H10Cl2N2O4 — CID 61024449
5-[[(5,6-dichloropyridine-3-carbonyl)amino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 61024449) has the molecular formula C13H10Cl2N2O4 and a molecular weight of 329.14 g/mol. Its IUPAC name is 5-[[(5,6-dichloropyridine-3-carbonyl)amino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[(5,6-dichloropyridine-3-carbonyl)amino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 61024449 |
| Molecular Formula | C13H10Cl2N2O4 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 5-[[(5,6-dichloropyridine-3-carbonyl)amino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CNC(=O)c2cnc(Cl)c(Cl)c2)cc1C(=O)O |
| InChI | InChI=1S/C13H10Cl2N2O4/c1-6-9(13(19)20)3-8(21-6)5-17-12(18)7-2-10(14)11(15)16-4-7/h2-4H,5H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | FZMQFLHRMUEZEH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|