C14H19Cl2N3O2 — CID 108570671
3,4-dichloro-N-[2-(diethylcarbamoylamino)ethyl]benzamide (PubChem CID 108570671) has the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.23 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(diethylcarbamoylamino)ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(diethylcarbamoylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 108570671 |
| Molecular Formula | C14H19Cl2N3O2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 3,4-dichloro-N-[2-(diethylcarbamoylamino)ethyl]benzamide |
| SMILES | CCN(CC)C(=O)NCCNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H19Cl2N3O2/c1-3-19(4-2)14(21)18-8-7-17-13(20)10-5-6-11(15)12(16)9-10/h5-6,9H,3-4,7-8H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | SBBAUQKYOFRILK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|