C13H8ClF3N2OS — CID 78804077
N-(4-chloro-2-fluorophenyl)-2-(difluoromethylsulfanyl)pyridine-3-carboxamide (PubChem CID 78804077) has the molecular formula C13H8ClF3N2OS and a molecular weight of 332.73 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-(difluoromethylsulfanyl)pyridine-3-carboxamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-(difluoromethylsulfanyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 78804077 |
| Molecular Formula | C13H8ClF3N2OS |
| Molecular Weight | 332.73 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-(difluoromethylsulfanyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1F)c1cccnc1SC(F)F |
| InChI | InChI=1S/C13H8ClF3N2OS/c14-7-3-4-10(9(15)6-7)19-11(20)8-2-1-5-18-12(8)21-13(16)17/h1-6,13H,(H,19,20) |
| InChIKey | RHMCJXVGBHKYKO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.73 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |