C19H14ClFN2OS — CID 9097470
N-(4-chloro-2-fluorophenyl)-2-(4-methylphenyl)sulfanylpyridine-3-carboxamide (PubChem CID 9097470) has the molecular formula C19H14ClFN2OS and a molecular weight of 372.85 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-(4-methylphenyl)sulfanylpyridine-3-carboxamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-(4-methylphenyl)sulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 9097470 |
| Molecular Formula | C19H14ClFN2OS |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-(4-methylphenyl)sulfanylpyridine-3-carboxamide |
| SMILES | Cc1ccc(Sc2ncccc2C(=O)Nc2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C19H14ClFN2OS/c1-12-4-7-14(8-5-12)25-19-15(3-2-10-22-19)18(24)23-17-9-6-13(20)11-16(17)21/h2-11H,1H3,(H,23,24) |
| InChIKey | FSPTWLPBMDEKSO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |