C25H19ClFN3OS2 — CID 156859919
N-[3-(4-chloroanilino)sulfanyl-4-fluorophenyl]-2-(4-methylphenyl)sulfanylpyridine-3-carboxamide (PubChem CID 156859919) has the molecular formula C25H19ClFN3OS2 and a molecular weight of 496.03 g/mol. Its IUPAC name is N-[3-(4-chloroanilino)sulfanyl-4-fluorophenyl]-2-(4-methylphenyl)sulfanylpyridine-3-carboxamide.
| Compound Name | N-[3-(4-chloroanilino)sulfanyl-4-fluorophenyl]-2-(4-methylphenyl)sulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 156859919 |
| Molecular Formula | C25H19ClFN3OS2 |
| Molecular Weight | 496.03 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | N-[3-(4-chloroanilino)sulfanyl-4-fluorophenyl]-2-(4-methylphenyl)sulfanylpyridine-3-carboxamide |
| SMILES | Cc1ccc(Sc2ncccc2C(=O)Nc2ccc(F)c(SNc3ccc(Cl)cc3)c2)cc1 |
| InChI | InChI=1S/C25H19ClFN3OS2/c1-16-4-11-20(12-5-16)32-25-21(3-2-14-28-25)24(31)29-19-10-13-22(27)23(15-19)33-30-18-8-6-17(26)7-9-18/h2-15,30H,1H3,(H,29,31) |
| InChIKey | JCQDRJUPTYXZNW-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.03 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|