C18H13ClN2OS — CID 26086401
N-(3-chlorophenyl)-2-phenylsulfanylpyridine-3-carboxamide (PubChem CID 26086401) has the molecular formula C18H13ClN2OS and a molecular weight of 340.84 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-phenylsulfanylpyridine-3-carboxamide.
| Compound Name | N-(3-chlorophenyl)-2-phenylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 26086401 |
| Molecular Formula | C18H13ClN2OS |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | N-(3-chlorophenyl)-2-phenylsulfanylpyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cccnc1Sc1ccccc1 |
| InChI | InChI=1S/C18H13ClN2OS/c19-13-6-4-7-14(12-13)21-17(22)16-10-5-11-20-18(16)23-15-8-2-1-3-9-15/h1-12H,(H,21,22) |
| InChIKey | PKMDUUOQMTVYEU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |