C22H19N3O2S — CID 38326707
N-[3-(cyclopropanecarbonylamino)phenyl]-2-phenylsulfanylpyridine-3-carboxamide (PubChem CID 38326707) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[3-(cyclopropanecarbonylamino)phenyl]-2-phenylsulfanylpyridine-3-carboxamide.
| Compound Name | N-[3-(cyclopropanecarbonylamino)phenyl]-2-phenylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 38326707 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[3-(cyclopropanecarbonylamino)phenyl]-2-phenylsulfanylpyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)C2CC2)c1)c1cccnc1Sc1ccccc1 |
| InChI | InChI=1S/C22H19N3O2S/c26-20(15-11-12-15)24-16-6-4-7-17(14-16)25-21(27)19-10-5-13-23-22(19)28-18-8-2-1-3-9-18/h1-10,13-15H,11-12H2,(H,24,26)(H,25,27) |
| InChIKey | CPLDNZRXUYEOIJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |